C12H18N6S — CID 46988532
N-[(3-methyl-1-prop-2-enylpyrazol-4-yl)methyl]-2-(2H-triazol-4-ylsulfanyl)ethanamine (PubChem CID 46988532) has the molecular formula C12H18N6S and a molecular weight of 278.38 g/mol. Its IUPAC name is N-[(3-methyl-1-prop-2-enylpyrazol-4-yl)methyl]-2-(2H-triazol-4-ylsulfanyl)ethanamine.
| Compound Name | N-[(3-methyl-1-prop-2-enylpyrazol-4-yl)methyl]-2-(2H-triazol-4-ylsulfanyl)ethanamine |
|---|---|
| PubChem CID | 46988532 |
| Molecular Formula | C12H18N6S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | N-[(3-methyl-1-prop-2-enylpyrazol-4-yl)methyl]-2-(2H-triazol-4-ylsulfanyl)ethanamine |
| SMILES | C=CCn1cc(CNCCSc2cn[nH]n2)c(C)n1 |
| InChI | InChI=1S/C12H18N6S/c1-3-5-18-9-11(10(2)16-18)7-13-4-6-19-12-8-14-17-15-12/h3,8-9,13H,1,4-7H2,2H3,(H,14,15,17) |
| InChIKey | UCYRNHUOCFMOJG-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|