C14H21N5O — CID 94595326
(1S)-1-(1-methylimidazol-2-yl)-2-[(3-methyl-1-prop-2-enylpyrazol-4-yl)methylamino]ethanol (PubChem CID 94595326) has the molecular formula C14H21N5O and a molecular weight of 275.36 g/mol. Its IUPAC name is (1S)-1-(1-methylimidazol-2-yl)-2-[(3-methyl-1-prop-2-enylpyrazol-4-yl)methylamino]ethanol.
| Compound Name | (1S)-1-(1-methylimidazol-2-yl)-2-[(3-methyl-1-prop-2-enylpyrazol-4-yl)methylamino]ethanol |
|---|---|
| PubChem CID | 94595326 |
| Molecular Formula | C14H21N5O |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | (1S)-1-(1-methylimidazol-2-yl)-2-[(3-methyl-1-prop-2-enylpyrazol-4-yl)methylamino]ethanol |
| SMILES | C=CCn1cc(CNC[C@H](O)c2nccn2C)c(C)n1 |
| InChI | InChI=1S/C14H21N5O/c1-4-6-19-10-12(11(2)17-19)8-15-9-13(20)14-16-5-7-18(14)3/h4-5,7,10,13,15,20H,1,6,8-9H2,2-3H3/t13-/m0/s1 |
| InChIKey | KNQDMADZIKNUBI-ZDUSSCGKSA-N |
| XLogP | 0.93 |
| TPSA | 67.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|