C19H23N5 — CID 46989004
2-imidazol-1-yl-N-[(3-methyl-1-prop-2-enylpyrazol-4-yl)methyl]-1-phenylethanamine (PubChem CID 46989004) has the molecular formula C19H23N5 and a molecular weight of 321.43 g/mol. Its IUPAC name is 2-imidazol-1-yl-N-[(3-methyl-1-prop-2-enylpyrazol-4-yl)methyl]-1-phenylethanamine.
| Compound Name | 2-imidazol-1-yl-N-[(3-methyl-1-prop-2-enylpyrazol-4-yl)methyl]-1-phenylethanamine |
|---|---|
| PubChem CID | 46989004 |
| Molecular Formula | C19H23N5 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.20 |
| IUPAC Name | 2-imidazol-1-yl-N-[(3-methyl-1-prop-2-enylpyrazol-4-yl)methyl]-1-phenylethanamine |
| SMILES | C=CCn1cc(CNC(Cn2ccnc2)c2ccccc2)c(C)n1 |
| InChI | InChI=1S/C19H23N5/c1-3-10-24-13-18(16(2)22-24)12-21-19(14-23-11-9-20-15-23)17-7-5-4-6-8-17/h3-9,11,13,15,19,21H,1,10,12,14H2,2H3 |
| InChIKey | JLWLJQVJZXTMAB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|