C11H14I2N2O — CID 70565783
2-[2-(aminomethyl)pyrrolidin-1-yl]-4,6-diiodophenol (PubChem CID 70565783) has the molecular formula C11H14I2N2O and a molecular weight of 444.05 g/mol. Its IUPAC name is 2-[2-(aminomethyl)pyrrolidin-1-yl]-4,6-diiodophenol.
| Compound Name | 2-[2-(aminomethyl)pyrrolidin-1-yl]-4,6-diiodophenol |
|---|---|
| PubChem CID | 70565783 |
| Molecular Formula | C11H14I2N2O |
| Molecular Weight | 444.05 g/mol |
| Exact Mass | 443.92 |
| IUPAC Name | 2-[2-(aminomethyl)pyrrolidin-1-yl]-4,6-diiodophenol |
| SMILES | NCC1CCCN1c1cc(I)cc(I)c1O |
| InChI | InChI=1S/C11H14I2N2O/c12-7-4-9(13)11(16)10(5-7)15-3-1-2-8(15)6-14/h4-5,8,16H,1-3,6,14H2 |
| InChIKey | FMVNUXFUSLYYKP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.05 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|