C19H32N2O — CID 88546796
2-[2-(aminomethyl)pyrrolidin-1-yl]-4,6-ditert-butylphenol (PubChem CID 88546796) has the molecular formula C19H32N2O and a molecular weight of 304.48 g/mol. Its IUPAC name is 2-[2-(aminomethyl)pyrrolidin-1-yl]-4,6-ditert-butylphenol.
| Compound Name | 2-[2-(aminomethyl)pyrrolidin-1-yl]-4,6-ditert-butylphenol |
|---|---|
| PubChem CID | 88546796 |
| Molecular Formula | C19H32N2O |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.25 |
| IUPAC Name | 2-[2-(aminomethyl)pyrrolidin-1-yl]-4,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(N2CCCC2CN)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H32N2O/c1-18(2,3)13-10-15(19(4,5)6)17(22)16(11-13)21-9-7-8-14(21)12-20/h10-11,14,22H,7-9,12,20H2,1-6H3 |
| InChIKey | FCECSQNAJRFPCX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |