C36H59NO2 — CID 158827924
2,4-ditert-butyl-6-(2-butylpyrrolidin-1-yl)phenol;3,5-ditert-butylphenol (PubChem CID 158827924) has the molecular formula C36H59NO2 and a molecular weight of 537.87 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-(2-butylpyrrolidin-1-yl)phenol;3,5-ditert-butylphenol.
| Compound Name | 2,4-ditert-butyl-6-(2-butylpyrrolidin-1-yl)phenol;3,5-ditert-butylphenol |
|---|---|
| PubChem CID | 158827924 |
| Molecular Formula | C36H59NO2 |
| Molecular Weight | 537.87 g/mol |
| Exact Mass | 537.45 |
| IUPAC Name | 2,4-ditert-butyl-6-(2-butylpyrrolidin-1-yl)phenol;3,5-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(O)cc(C(C)(C)C)c1.CCCCC1CCCN1c1cc(C(C)(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C22H37NO.C14H22O/c1-8-9-11-17-12-10-13-23(17)19-15-16(21(2,3)4)14-18(20(19)24)22(5,6)7;1-13(2,3)10-7-11(14(4,5)6)9-12(15)8-10/h14-15,17,24H,8-13H2,1-7H3;7-9,15H,1-6H3 |
| InChIKey | IWRGZULCHAVKQP-UHFFFAOYSA-N |
| XLogP | 10.13 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.87 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |