C14H10BrClN2O2S — CID 70567586
ethyl 6-bromo-5-chloro-3-(1,3-thiazol-2-yl)-1H-indole-2-carboxylate (PubChem CID 70567586) has the molecular formula C14H10BrClN2O2S and a molecular weight of 385.67 g/mol. Its IUPAC name is ethyl 6-bromo-5-chloro-3-(1,3-thiazol-2-yl)-1H-indole-2-carboxylate.
| Compound Name | ethyl 6-bromo-5-chloro-3-(1,3-thiazol-2-yl)-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 70567586 |
| Molecular Formula | C14H10BrClN2O2S |
| Molecular Weight | 385.67 g/mol |
| Exact Mass | 383.93 |
| IUPAC Name | ethyl 6-bromo-5-chloro-3-(1,3-thiazol-2-yl)-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2cc(Br)c(Cl)cc2c1-c1nccs1 |
| InChI | InChI=1S/C14H10BrClN2O2S/c1-2-20-14(19)12-11(13-17-3-4-21-13)7-5-9(16)8(15)6-10(7)18-12/h3-6,18H,2H2,1H3 |
| InChIKey | GKCYSYDDYIYKOS-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.67 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |