C18H18Cl2N2O4S — CID 70567884
4-[4-chloro-3-[(2-chlorophenyl)methylsulfamoyl]phenyl]-N-methyl-4-oxobutanamide (PubChem CID 70567884) has the molecular formula C18H18Cl2N2O4S and a molecular weight of 429.33 g/mol. Its IUPAC name is 4-[4-chloro-3-[(2-chlorophenyl)methylsulfamoyl]phenyl]-N-methyl-4-oxobutanamide.
| Compound Name | 4-[4-chloro-3-[(2-chlorophenyl)methylsulfamoyl]phenyl]-N-methyl-4-oxobutanamide |
|---|---|
| PubChem CID | 70567884 |
| Molecular Formula | C18H18Cl2N2O4S |
| Molecular Weight | 429.33 g/mol |
| Exact Mass | 428.04 |
| IUPAC Name | 4-[4-chloro-3-[(2-chlorophenyl)methylsulfamoyl]phenyl]-N-methyl-4-oxobutanamide |
| SMILES | CNC(=O)CCC(=O)c1ccc(Cl)c(S(=O)(=O)NCc2ccccc2Cl)c1 |
| InChI | InChI=1S/C18H18Cl2N2O4S/c1-21-18(24)9-8-16(23)12-6-7-15(20)17(10-12)27(25,26)22-11-13-4-2-3-5-14(13)19/h2-7,10,22H,8-9,11H2,1H3,(H,21,24) |
| InChIKey | FQDOGJIHYLAMBZ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |