C30H35NO8 — CID 70568550
(4R,4aS,7S,7aR,12bS)-3-(cyclobutylmethyl)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,7,9-triol;2-acetyloxybenzoic acid (PubChem CID 70568550) has the molecular formula C30H35NO8 and a molecular weight of 537.61 g/mol. Its IUPAC name is (4R,4aS,7S,7aR,12bS)-3-(cyclobutylmethyl)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,7,9-triol;2-acetyloxybenzoic acid.
| Compound Name | (4R,4aS,7S,7aR,12bS)-3-(cyclobutylmethyl)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,7,9-triol;2-acetyloxybenzoic acid |
|---|---|
| PubChem CID | 70568550 |
| Molecular Formula | C30H35NO8 |
| Molecular Weight | 537.61 g/mol |
| Exact Mass | 537.24 |
| IUPAC Name | (4R,4aS,7S,7aR,12bS)-3-(cyclobutylmethyl)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,7,9-triol;2-acetyloxybenzoic acid |
| SMILES | CC(=O)Oc1ccccc1C(=O)O.Oc1ccc2c3c1O[C@H]1[C@@H](O)CC[C@@]4(O)[C@@H](C2)N(CC2CCC2)CC[C@]314 |
| InChI | InChI=1S/C21H27NO4.C9H8O4/c23-14-5-4-13-10-16-21(25)7-6-15(24)19-20(21,17(13)18(14)26-19)8-9-22(16)11-12-2-1-3-12;1-6(10)13-8-5-3-2-4-7(8)9(11)12/h4-5,12,15-16,19,23-25H,1-3,6-11H2;2-5H,1H3,(H,11,12)/t15-,16+,19-,20-,21+;/m0./s1 |
| InChIKey | ZQLSZKOZLWLUIW-BCXQGASESA-N |
| XLogP | 3.02 |
| TPSA | 136.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.61 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|