C31H40O10 — CID 70568578
[2-(2-hydroxypropoxy)-2-[4-[1-[4-[1-(2-hydroxypropoxy)-2-prop-2-enoyloxyethoxy]phenyl]propyl]phenoxy]ethyl] prop-2-enoate (PubChem CID 70568578) has the molecular formula C31H40O10 and a molecular weight of 572.65 g/mol. Its IUPAC name is [2-(2-hydroxypropoxy)-2-[4-[1-[4-[1-(2-hydroxypropoxy)-2-prop-2-enoyloxyethoxy]phenyl]propyl]phenoxy]ethyl] prop-2-enoate.
| Compound Name | [2-(2-hydroxypropoxy)-2-[4-[1-[4-[1-(2-hydroxypropoxy)-2-prop-2-enoyloxyethoxy]phenyl]propyl]phenoxy]ethyl] prop-2-enoate |
|---|---|
| PubChem CID | 70568578 |
| Molecular Formula | C31H40O10 |
| Molecular Weight | 572.65 g/mol |
| Exact Mass | 572.26 |
| IUPAC Name | [2-(2-hydroxypropoxy)-2-[4-[1-[4-[1-(2-hydroxypropoxy)-2-prop-2-enoyloxyethoxy]phenyl]propyl]phenoxy]ethyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(OCC(C)O)Oc1ccc(C(CC)c2ccc(OC(COC(=O)C=C)OCC(C)O)cc2)cc1 |
| InChI | InChI=1S/C31H40O10/c1-6-27(23-9-13-25(14-10-23)40-30(38-17-21(4)32)19-36-28(34)7-2)24-11-15-26(16-12-24)41-31(39-18-22(5)33)20-37-29(35)8-3/h7-16,21-22,27,30-33H,2-3,6,17-20H2,1,4-5H3 |
| InChIKey | HUCXGZAWFDIXDJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.65 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|