C14H21ClO3 — CID 70569257
1-[(2-chlorophenyl)methoxy]-5-methylhexane-2,5-diol (PubChem CID 70569257) has the molecular formula C14H21ClO3 and a molecular weight of 272.77 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methoxy]-5-methylhexane-2,5-diol.
| Compound Name | 1-[(2-chlorophenyl)methoxy]-5-methylhexane-2,5-diol |
|---|---|
| PubChem CID | 70569257 |
| Molecular Formula | C14H21ClO3 |
| Molecular Weight | 272.77 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 1-[(2-chlorophenyl)methoxy]-5-methylhexane-2,5-diol |
| SMILES | CC(C)(O)CCC(O)COCc1ccccc1Cl |
| InChI | InChI=1S/C14H21ClO3/c1-14(2,17)8-7-12(16)10-18-9-11-5-3-4-6-13(11)15/h3-6,12,16-17H,7-10H2,1-2H3 |
| InChIKey | UUUQGBSKSAJKRE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.77 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |