C15H24ClNO2 — CID 110909172
1-[(2-chlorophenyl)methoxy]-3-[methyl(2-methylpropyl)amino]propan-2-ol (PubChem CID 110909172) has the molecular formula C15H24ClNO2 and a molecular weight of 285.81 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methoxy]-3-[methyl(2-methylpropyl)amino]propan-2-ol.
| Compound Name | 1-[(2-chlorophenyl)methoxy]-3-[methyl(2-methylpropyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 110909172 |
| Molecular Formula | C15H24ClNO2 |
| Molecular Weight | 285.81 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 1-[(2-chlorophenyl)methoxy]-3-[methyl(2-methylpropyl)amino]propan-2-ol |
| SMILES | CC(C)CN(C)CC(O)COCc1ccccc1Cl |
| InChI | InChI=1S/C15H24ClNO2/c1-12(2)8-17(3)9-14(18)11-19-10-13-6-4-5-7-15(13)16/h4-7,12,14,18H,8-11H2,1-3H3 |
| InChIKey | KCEYJHQPLQNZIH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.81 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |