C16H27ClNO2+ — CID 7830770
[(2R)-3-[(2-chlorophenyl)methoxy]-2-hydroxypropyl]-di(propan-2-yl)azanium (PubChem CID 7830770) has the molecular formula C16H27ClNO2+ and a molecular weight of 300.85 g/mol. Its IUPAC name is [(2R)-3-[(2-chlorophenyl)methoxy]-2-hydroxypropyl]-di(propan-2-yl)azanium.
| Compound Name | [(2R)-3-[(2-chlorophenyl)methoxy]-2-hydroxypropyl]-di(propan-2-yl)azanium |
|---|---|
| PubChem CID | 7830770 |
| Molecular Formula | C16H27ClNO2+ |
| Molecular Weight | 300.85 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | [(2R)-3-[(2-chlorophenyl)methoxy]-2-hydroxypropyl]-di(propan-2-yl)azanium |
| SMILES | CC(C)[NH+](C[C@@H](O)COCc1ccccc1Cl)C(C)C |
| InChI | InChI=1S/C16H26ClNO2/c1-12(2)18(13(3)4)9-15(19)11-20-10-14-7-5-6-8-16(14)17/h5-8,12-13,15,19H,9-11H2,1-4H3/p+1/t15-/m1/s1 |
| InChIKey | YINUQJDQMVSQHM-OAHLLOKOSA-O |
| XLogP | 1.92 |
| TPSA | 33.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.85 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |