C12H16N2O5S — CID 70571174
3-ethyl-2,6-dimethylpyrido[1,2-a]pyrimidin-1-ium-4-one;hydron;sulfate (PubChem CID 70571174) has the molecular formula C12H16N2O5S and a molecular weight of 300.34 g/mol. Its IUPAC name is 3-ethyl-2,6-dimethylpyrido[1,2-a]pyrimidin-1-ium-4-one;hydron;sulfate.
| Compound Name | 3-ethyl-2,6-dimethylpyrido[1,2-a]pyrimidin-1-ium-4-one;hydron;sulfate |
|---|---|
| PubChem CID | 70571174 |
| Molecular Formula | C12H16N2O5S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 3-ethyl-2,6-dimethylpyrido[1,2-a]pyrimidin-1-ium-4-one;hydron;sulfate |
| SMILES | CCc1c(C)[nH+]c2cccc(C)n2c1=O.O=S(=O)([O-])[O-].[H+] |
| InChI | InChI=1S/C12H14N2O.H2O4S/c1-4-10-9(3)13-11-7-5-6-8(2)14(11)12(10)15;1-5(2,3)4/h5-7H,4H2,1-3H3;(H2,1,2,3,4) |
| InChIKey | CWTGXBLHXDRWCC-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 115.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|