C16H18N2O5 — CID 70569958
(Z)-but-2-enedioate;3-ethyl-2,6-dimethylpyrido[1,2-a]pyrimidin-1-ium-4-one;hydron (PubChem CID 70569958) has the molecular formula C16H18N2O5 and a molecular weight of 318.33 g/mol. Its IUPAC name is (Z)-but-2-enedioate;3-ethyl-2,6-dimethylpyrido[1,2-a]pyrimidin-1-ium-4-one;hydron.
| Compound Name | (Z)-but-2-enedioate;3-ethyl-2,6-dimethylpyrido[1,2-a]pyrimidin-1-ium-4-one;hydron |
|---|---|
| PubChem CID | 70569958 |
| Molecular Formula | C16H18N2O5 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | (Z)-but-2-enedioate;3-ethyl-2,6-dimethylpyrido[1,2-a]pyrimidin-1-ium-4-one;hydron |
| SMILES | CCc1c(C)[nH+]c2cccc(C)n2c1=O.O=C([O-])/C=C\C(=O)[O-].[H+] |
| InChI | InChI=1S/C12H14N2O.C4H4O4/c1-4-10-9(3)13-11-7-5-6-8(2)14(11)12(10)15;5-3(6)1-2-4(7)8/h5-7H,4H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | RZMYHGSPPJKQKD-BTJKTKAUSA-N |
| XLogP | -1.55 |
| TPSA | 115.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|