C17H25NO — CID 70571387
6-(3-methoxyphenyl)-4,8-dimethyl-2-azabicyclo[3.3.1]nonane (PubChem CID 70571387) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is 6-(3-methoxyphenyl)-4,8-dimethyl-2-azabicyclo[3.3.1]nonane.
| Compound Name | 6-(3-methoxyphenyl)-4,8-dimethyl-2-azabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 70571387 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 6-(3-methoxyphenyl)-4,8-dimethyl-2-azabicyclo[3.3.1]nonane |
| SMILES | COc1cccc(C2CC(C)C3CC2C(C)CN3)c1 |
| InChI | InChI=1S/C17H25NO/c1-11-7-16(13-5-4-6-14(8-13)19-3)15-9-17(11)18-10-12(15)2/h4-6,8,11-12,15-18H,7,9-10H2,1-3H3 |
| InChIKey | UGILUHBGFUUQCC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |