C25H34N2O5 — CID 70572774
2-[2-(4-benzhydrylpiperidin-1-yl)-2-oxoethoxy]acetate;2-hydroxypropylazanium (PubChem CID 70572774) has the molecular formula C25H34N2O5 and a molecular weight of 442.56 g/mol. Its IUPAC name is 2-[2-(4-benzhydrylpiperidin-1-yl)-2-oxoethoxy]acetate;2-hydroxypropylazanium.
| Compound Name | 2-[2-(4-benzhydrylpiperidin-1-yl)-2-oxoethoxy]acetate;2-hydroxypropylazanium |
|---|---|
| PubChem CID | 70572774 |
| Molecular Formula | C25H34N2O5 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | 2-[2-(4-benzhydrylpiperidin-1-yl)-2-oxoethoxy]acetate;2-hydroxypropylazanium |
| SMILES | CC(O)C[NH3+].O=C([O-])COCC(=O)N1CCC(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C22H25NO4.C3H9NO/c24-20(15-27-16-21(25)26)23-13-11-19(12-14-23)22(17-7-3-1-4-8-17)18-9-5-2-6-10-18;1-3(5)2-4/h1-10,19,22H,11-16H2,(H,25,26);3,5H,2,4H2,1H3 |
| InChIKey | QTZWKROMMWXIIY-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 117.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |