C29H34N2O4S — CID 90316654
[4-(diethylsulfamoyl)phenyl] 4-benzhydrylpiperidine-1-carboxylate (PubChem CID 90316654) has the molecular formula C29H34N2O4S and a molecular weight of 506.67 g/mol. Its IUPAC name is [4-(diethylsulfamoyl)phenyl] 4-benzhydrylpiperidine-1-carboxylate.
| Compound Name | [4-(diethylsulfamoyl)phenyl] 4-benzhydrylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 90316654 |
| Molecular Formula | C29H34N2O4S |
| Molecular Weight | 506.67 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | [4-(diethylsulfamoyl)phenyl] 4-benzhydrylpiperidine-1-carboxylate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(OC(=O)N2CCC(C(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C29H34N2O4S/c1-3-31(4-2)36(33,34)27-17-15-26(16-18-27)35-29(32)30-21-19-25(20-22-30)28(23-11-7-5-8-12-23)24-13-9-6-10-14-24/h5-18,25,28H,3-4,19-22H2,1-2H3 |
| InChIKey | QYNXXQRXAUVMTK-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.67 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |