C9H15NO2 — CID 7057356
(1S,3S,5R)-1-(methylaminomethyl)-8-oxabicyclo[3.2.1]oct-6-en-3-ol (PubChem CID 7057356) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is (1S,3S,5R)-1-(methylaminomethyl)-8-oxabicyclo[3.2.1]oct-6-en-3-ol.
| Compound Name | (1S,3S,5R)-1-(methylaminomethyl)-8-oxabicyclo[3.2.1]oct-6-en-3-ol |
|---|---|
| PubChem CID | 7057356 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | (1S,3S,5R)-1-(methylaminomethyl)-8-oxabicyclo[3.2.1]oct-6-en-3-ol |
| SMILES | CNC[C@@]12C=C[C@@H](C[C@H](O)C1)O2 |
| InChI | InChI=1S/C9H15NO2/c1-10-6-9-3-2-8(12-9)4-7(11)5-9/h2-3,7-8,10-11H,4-6H2,1H3/t7-,8-,9+/m0/s1 |
| InChIKey | ZBJWBKMYJBMAQK-XHNCKOQMSA-N |
| XLogP | 0.05 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|