C8H12O — CID 141194938
1-ethyl-7-oxabicyclo[2.2.1]hept-2-ene (PubChem CID 141194938) has the molecular formula C8H12O and a molecular weight of 124.18 g/mol. Its IUPAC name is 1-ethyl-7-oxabicyclo[2.2.1]hept-2-ene.
| Compound Name | 1-ethyl-7-oxabicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 141194938 |
| Molecular Formula | C8H12O |
| Molecular Weight | 124.18 g/mol |
| Exact Mass | 124.09 |
| IUPAC Name | 1-ethyl-7-oxabicyclo[2.2.1]hept-2-ene |
| SMILES | CCC12C=CC(CC1)O2 |
| InChI | InChI=1S/C8H12O/c1-2-8-5-3-7(9-8)4-6-8/h3,5,7H,2,4,6H2,1H3 |
| InChIKey | SVQNHEFGNBEOTO-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.18 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|