C9H16NO2+ — CID 7057357
[(1R,3S,5S)-3-hydroxy-8-oxabicyclo[3.2.1]oct-6-en-1-yl]methyl-methylazanium (PubChem CID 7057357) has the molecular formula C9H16NO2+ and a molecular weight of 170.23 g/mol. Its IUPAC name is [(1R,3S,5S)-3-hydroxy-8-oxabicyclo[3.2.1]oct-6-en-1-yl]methyl-methylazanium.
| Compound Name | [(1R,3S,5S)-3-hydroxy-8-oxabicyclo[3.2.1]oct-6-en-1-yl]methyl-methylazanium |
|---|---|
| PubChem CID | 7057357 |
| Molecular Formula | C9H16NO2+ |
| Molecular Weight | 170.23 g/mol |
| Exact Mass | 170.12 |
| IUPAC Name | [(1R,3S,5S)-3-hydroxy-8-oxabicyclo[3.2.1]oct-6-en-1-yl]methyl-methylazanium |
| SMILES | C[NH2+]C[C@]12C=C[C@H](C[C@H](O)C1)O2 |
| InChI | InChI=1S/C9H15NO2/c1-10-6-9-3-2-8(12-9)4-7(11)5-9/h2-3,7-8,10-11H,4-6H2,1H3/p+1/t7-,8+,9-/m0/s1 |
| InChIKey | ZBJWBKMYJBMAQK-YIZRAAEISA-O |
| XLogP | -0.97 |
| TPSA | 46.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.23 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|