C10H18NO2+ — CID 7057361
[(1R,3R,5S)-3-hydroxy-5-methyl-8-oxabicyclo[3.2.1]oct-6-en-1-yl]methyl-methylazanium (PubChem CID 7057361) has the molecular formula C10H18NO2+ and a molecular weight of 184.26 g/mol. Its IUPAC name is [(1R,3R,5S)-3-hydroxy-5-methyl-8-oxabicyclo[3.2.1]oct-6-en-1-yl]methyl-methylazanium.
| Compound Name | [(1R,3R,5S)-3-hydroxy-5-methyl-8-oxabicyclo[3.2.1]oct-6-en-1-yl]methyl-methylazanium |
|---|---|
| PubChem CID | 7057361 |
| Molecular Formula | C10H18NO2+ |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | [(1R,3R,5S)-3-hydroxy-5-methyl-8-oxabicyclo[3.2.1]oct-6-en-1-yl]methyl-methylazanium |
| SMILES | C[NH2+]C[C@]12C=C[C@](C)(C[C@@H](O)C1)O2 |
| InChI | InChI=1S/C10H17NO2/c1-9-3-4-10(13-9,7-11-2)6-8(12)5-9/h3-4,8,11-12H,5-7H2,1-2H3/p+1/t8-,9-,10+/m1/s1 |
| InChIKey | GYFKEMWJNPKAJW-BBBLOLIVSA-O |
| XLogP | -0.58 |
| TPSA | 46.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|