C11H18O2 — CID 85287732
1-methyl-4-propan-2-yl-8-oxabicyclo[3.2.1]oct-6-en-3-ol (PubChem CID 85287732) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is 1-methyl-4-propan-2-yl-8-oxabicyclo[3.2.1]oct-6-en-3-ol.
| Compound Name | 1-methyl-4-propan-2-yl-8-oxabicyclo[3.2.1]oct-6-en-3-ol |
|---|---|
| PubChem CID | 85287732 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 1-methyl-4-propan-2-yl-8-oxabicyclo[3.2.1]oct-6-en-3-ol |
| SMILES | CC(C)C1C(O)CC2(C)C=CC1O2 |
| InChI | InChI=1S/C11H18O2/c1-7(2)10-8(12)6-11(3)5-4-9(10)13-11/h4-5,7-10,12H,6H2,1-3H3 |
| InChIKey | SGXIIKOGIWNRPS-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|