About 2-bromo-N-pentyl-1,3-thiazol-4-amine
2-bromo-N-pentyl-1,3-thiazol-4-amine (PubChem CID 70578274) has the molecular formula C8H13BrN2S
and a molecular weight of 249.18 g/mol. Its IUPAC name is 2-bromo-N-pentyl-1,3-thiazol-4-amine.
Molecular Properties
| Compound Name | 2-bromo-N-pentyl-1,3-thiazol-4-amine |
| PubChem CID | 70578274 |
| Molecular Formula | C8H13BrN2S |
| Molecular Weight | 249.18 g/mol |
| Exact Mass | 248.00 |
| IUPAC Name | 2-bromo-N-pentyl-1,3-thiazol-4-amine |
| SMILES | CCCCCNc1csc(Br)n1 |
| InChI | InChI=1S/C8H13BrN2S/c1-2-3-4-5-10-7-6-12-8(9)11-7/h6,10H,2-5H2,1H3 |
| InChIKey | YLHYNQWDUWMGFP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.18 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-N-pentyl-1,3-thiazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N-pentyl-1,3-thiazol-4-amine?
The IUPAC name of 2-bromo-N-pentyl-1,3-thiazol-4-amine (CID 70578274) is 2-bromo-N-pentyl-1,3-thiazol-4-amine.
What is the SMILES notation for 2-bromo-N-pentyl-1,3-thiazol-4-amine?
The canonical SMILES for 2-bromo-N-pentyl-1,3-thiazol-4-amine is CCCCCNc1csc(Br)n1.
What is the InChIKey of 2-bromo-N-pentyl-1,3-thiazol-4-amine?
The InChIKey is YLHYNQWDUWMGFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13BrN2S/c1-2-3-4-5-10-7-6-12-8(9)11-7/h6,10H,2-5H2,1H3.
What are the key properties of 2-bromo-N-pentyl-1,3-thiazol-4-amine?
2-bromo-N-pentyl-1,3-thiazol-4-amine has a molecular weight of 249.18 g/mol, XLogP of 3.51, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N-pentyl-1,3-thiazol-4-amine is sourced from PubChem (CID 70578274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).