C18H18N4O5S — CID 70578684
N-[2-[4-(carbamoylsulfamoyl)phenyl]ethyl]-3-oxo-1H-isoindole-2-carboxamide (PubChem CID 70578684) has the molecular formula C18H18N4O5S and a molecular weight of 402.43 g/mol. Its IUPAC name is N-[2-[4-(carbamoylsulfamoyl)phenyl]ethyl]-3-oxo-1H-isoindole-2-carboxamide.
| Compound Name | N-[2-[4-(carbamoylsulfamoyl)phenyl]ethyl]-3-oxo-1H-isoindole-2-carboxamide |
|---|---|
| PubChem CID | 70578684 |
| Molecular Formula | C18H18N4O5S |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | N-[2-[4-(carbamoylsulfamoyl)phenyl]ethyl]-3-oxo-1H-isoindole-2-carboxamide |
| SMILES | NC(=O)NS(=O)(=O)c1ccc(CCNC(=O)N2Cc3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C18H18N4O5S/c19-17(24)21-28(26,27)14-7-5-12(6-8-14)9-10-20-18(25)22-11-13-3-1-2-4-15(13)16(22)23/h1-8H,9-11H2,(H,20,25)(H3,19,21,24) |
| InChIKey | HVJGAIJSRGTSIX-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |