C24H28N4O5S2 — CID 88772732
N-[2-[4-[cyclohexylcarbamoyl(sulfanyl)sulfamoyl]phenyl]ethyl]-3-oxo-1H-isoindole-2-carboxamide (PubChem CID 88772732) has the molecular formula C24H28N4O5S2 and a molecular weight of 516.65 g/mol. Its IUPAC name is N-[2-[4-[cyclohexylcarbamoyl(sulfanyl)sulfamoyl]phenyl]ethyl]-3-oxo-1H-isoindole-2-carboxamide.
| Compound Name | N-[2-[4-[cyclohexylcarbamoyl(sulfanyl)sulfamoyl]phenyl]ethyl]-3-oxo-1H-isoindole-2-carboxamide |
|---|---|
| PubChem CID | 88772732 |
| Molecular Formula | C24H28N4O5S2 |
| Molecular Weight | 516.65 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | N-[2-[4-[cyclohexylcarbamoyl(sulfanyl)sulfamoyl]phenyl]ethyl]-3-oxo-1H-isoindole-2-carboxamide |
| SMILES | O=C(NCCc1ccc(S(=O)(=O)N(S)C(=O)NC2CCCCC2)cc1)N1Cc2ccccc2C1=O |
| InChI | InChI=1S/C24H28N4O5S2/c29-22-21-9-5-4-6-18(21)16-27(22)23(30)25-15-14-17-10-12-20(13-11-17)35(32,33)28(34)24(31)26-19-7-2-1-3-8-19/h4-6,9-13,19,34H,1-3,7-8,14-16H2,(H,25,30)(H,26,31) |
| InChIKey | LUZURNKBWPNSMF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.65 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|