C10H14O6P+ — CID 70579978
1,3-dihydroxypropan-2-one;hydroxy-[hydroxy(phenyl)methyl]-oxophosphanium (PubChem CID 70579978) has the molecular formula C10H14O6P+ and a molecular weight of 261.19 g/mol. Its IUPAC name is 1,3-dihydroxypropan-2-one;hydroxy-[hydroxy(phenyl)methyl]-oxophosphanium.
| Compound Name | 1,3-dihydroxypropan-2-one;hydroxy-[hydroxy(phenyl)methyl]-oxophosphanium |
|---|---|
| PubChem CID | 70579978 |
| Molecular Formula | C10H14O6P+ |
| Molecular Weight | 261.19 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | 1,3-dihydroxypropan-2-one;hydroxy-[hydroxy(phenyl)methyl]-oxophosphanium |
| SMILES | O=C(CO)CO.O=[P+](O)C(O)c1ccccc1 |
| InChI | InChI=1S/C7H7O3P.C3H6O3/c8-7(11(9)10)6-4-2-1-3-5-6;4-1-3(6)2-5/h1-5,7-8H;4-5H,1-2H2/p+1 |
| InChIKey | CZSOUBCBPODYJS-UHFFFAOYSA-O |
| XLogP | -0.05 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.19 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|