C9H12O5 — CID 19905929
benzene-1,4-diol;1,3-dihydroxypropan-2-one (PubChem CID 19905929) has the molecular formula C9H12O5 and a molecular weight of 200.19 g/mol. Its IUPAC name is benzene-1,4-diol;1,3-dihydroxypropan-2-one.
| Compound Name | benzene-1,4-diol;1,3-dihydroxypropan-2-one |
|---|---|
| PubChem CID | 19905929 |
| Molecular Formula | C9H12O5 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | benzene-1,4-diol;1,3-dihydroxypropan-2-one |
| SMILES | O=C(CO)CO.Oc1ccc(O)cc1 |
| InChI | InChI=1S/C6H6O2.C3H6O3/c7-5-1-2-6(8)4-3-5;4-1-3(6)2-5/h1-4,7-8H;4-5H,1-2H2 |
| InChIKey | GULXOTYNYONBDX-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|