C20H20N6O9S2 — CID 70582767
(6R,7S)-7-[[2-carboxy-2-(3,4-dihydroxyphenyl)acetyl]amino]-7-methoxy-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 70582767) has the molecular formula C20H20N6O9S2 and a molecular weight of 552.55 g/mol. Its IUPAC name is (6R,7S)-7-[[2-carboxy-2-(3,4-dihydroxyphenyl)acetyl]amino]-7-methoxy-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7S)-7-[[2-carboxy-2-(3,4-dihydroxyphenyl)acetyl]amino]-7-methoxy-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 70582767 |
| Molecular Formula | C20H20N6O9S2 |
| Molecular Weight | 552.55 g/mol |
| Exact Mass | 552.07 |
| IUPAC Name | (6R,7S)-7-[[2-carboxy-2-(3,4-dihydroxyphenyl)acetyl]amino]-7-methoxy-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CO[C@@]1(NC(=O)C(C(=O)O)c2ccc(O)c(O)c2)C(=O)N2C(C(=O)O)=C(CSc3nnnn3C)CS[C@@H]21 |
| InChI | InChI=1S/C20H20N6O9S2/c1-25-19(22-23-24-25)37-7-9-6-36-18-20(35-2,17(34)26(18)13(9)16(32)33)21-14(29)12(15(30)31)8-3-4-10(27)11(28)5-8/h3-5,12,18,27-28H,6-7H2,1-2H3,(H,21,29)(H,30,31)(H,32,33)/t12?,18-,20+/m1/s1 |
| InChIKey | MEZXHOQGFQTAOB-CAVRMKNVSA-N |
| XLogP | -0.71 |
| TPSA | 217.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.55 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|