C30H40F2O9 — CID 70583287
[(6S,8S,9R,10S,11S,13S,14S,16R,17R)-17-(2-butoxycarbonyloxyacetyl)-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] ethyl carbonate (PubChem CID 70583287) has the molecular formula C30H40F2O9 and a molecular weight of 582.64 g/mol. Its IUPAC name is [(6S,8S,9R,10S,11S,13S,14S,16R,17R)-17-(2-butoxycarbonyloxyacetyl)-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] ethyl carbonate.
| Compound Name | [(6S,8S,9R,10S,11S,13S,14S,16R,17R)-17-(2-butoxycarbonyloxyacetyl)-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] ethyl carbonate |
|---|---|
| PubChem CID | 70583287 |
| Molecular Formula | C30H40F2O9 |
| Molecular Weight | 582.64 g/mol |
| Exact Mass | 582.26 |
| IUPAC Name | [(6S,8S,9R,10S,11S,13S,14S,16R,17R)-17-(2-butoxycarbonyloxyacetyl)-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] ethyl carbonate |
| SMILES | CCCCOC(=O)OCC(=O)[C@@]1(OC(=O)OCC)[C@H](C)C[C@H]2[C@@H]3C[C@H](F)C4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@@]21C |
| InChI | InChI=1S/C30H40F2O9/c1-6-8-11-39-25(36)40-16-24(35)30(41-26(37)38-7-2)17(3)12-19-20-14-22(31)21-13-18(33)9-10-27(21,4)29(20,32)23(34)15-28(19,30)5/h9-10,13,17,19-20,22-23,34H,6-8,11-12,14-16H2,1-5H3/t17-,19+,20+,22+,23+,27+,28+,29+,30+/m1/s1 |
| InChIKey | FRTRDTYGBDZNOW-BJZOHTFWSA-N |
| XLogP | 4.99 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.64 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|