C13H20N2O6 — CID 70584651
2-oxo-2-[(3S)-2-oxo-4-(2-oxopropoxy)-3-(pentylamino)azetidin-1-yl]acetic acid (PubChem CID 70584651) has the molecular formula C13H20N2O6 and a molecular weight of 300.31 g/mol. Its IUPAC name is 2-oxo-2-[(3S)-2-oxo-4-(2-oxopropoxy)-3-(pentylamino)azetidin-1-yl]acetic acid.
| Compound Name | 2-oxo-2-[(3S)-2-oxo-4-(2-oxopropoxy)-3-(pentylamino)azetidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 70584651 |
| Molecular Formula | C13H20N2O6 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 2-oxo-2-[(3S)-2-oxo-4-(2-oxopropoxy)-3-(pentylamino)azetidin-1-yl]acetic acid |
| SMILES | CCCCCN[C@@H]1C(=O)N(C(=O)C(=O)O)C1OCC(C)=O |
| InChI | InChI=1S/C13H20N2O6/c1-3-4-5-6-14-9-10(17)15(11(18)13(19)20)12(9)21-7-8(2)16/h9,12,14H,3-7H2,1-2H3,(H,19,20)/t9-,12?/m1/s1 |
| InChIKey | CVPAXCOUIPEDOE-PKEIRNPWSA-N |
| XLogP | -0.48 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|