About 6-(dimethylamino)-3,6-dimethylcyclohexa-2,4-dien-1-ol
6-(dimethylamino)-3,6-dimethylcyclohexa-2,4-dien-1-ol (PubChem CID 70584700) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is 6-(dimethylamino)-3,6-dimethylcyclohexa-2,4-dien-1-ol.
Analyze 6-(dimethylamino)-3,6-dimethylcyclohexa-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(dimethylamino)-3,6-dimethylcyclohexa-2,4-dien-1-ol?
The IUPAC name of 6-(dimethylamino)-3,6-dimethylcyclohexa-2,4-dien-1-ol (CID 70584700) is 6-(dimethylamino)-3,6-dimethylcyclohexa-2,4-dien-1-ol.
What is the SMILES notation for 6-(dimethylamino)-3,6-dimethylcyclohexa-2,4-dien-1-ol?
The canonical SMILES for 6-(dimethylamino)-3,6-dimethylcyclohexa-2,4-dien-1-ol is CC1=CC(O)C(C)(N(C)C)C=C1.
What is the InChIKey of 6-(dimethylamino)-3,6-dimethylcyclohexa-2,4-dien-1-ol?
The InChIKey is NITLLFACJLPWEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO/c1-8-5-6-10(2,11(3)4)9(12)7-8/h5-7,9,12H,1-4H3.
What are the key properties of 6-(dimethylamino)-3,6-dimethylcyclohexa-2,4-dien-1-ol?
6-(dimethylamino)-3,6-dimethylcyclohexa-2,4-dien-1-ol has a molecular weight of 167.25 g/mol, XLogP of 1.18, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(dimethylamino)-3,6-dimethylcyclohexa-2,4-dien-1-ol is sourced from PubChem (CID 70584700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).