C12H21NO — CID 143492500
(2S,3E)-3-ethenyl-1-[methyl(propan-2-yl)amino]hexa-3,5-dien-2-ol (PubChem CID 143492500) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is (2S,3E)-3-ethenyl-1-[methyl(propan-2-yl)amino]hexa-3,5-dien-2-ol.
| Compound Name | (2S,3E)-3-ethenyl-1-[methyl(propan-2-yl)amino]hexa-3,5-dien-2-ol |
|---|---|
| PubChem CID | 143492500 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | (2S,3E)-3-ethenyl-1-[methyl(propan-2-yl)amino]hexa-3,5-dien-2-ol |
| SMILES | C=C/C=C(\C=C)[C@H](O)CN(C)C(C)C |
| InChI | InChI=1S/C12H21NO/c1-6-8-11(7-2)12(14)9-13(5)10(3)4/h6-8,10,12,14H,1-2,9H2,3-5H3/b11-8+/t12-/m1/s1 |
| InChIKey | XUKRFGXPEVRYIN-JATZPVMKSA-N |
| XLogP | 1.99 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|