C13H23NO — CID 89240652
(3E,4Z)-1-(tert-butylamino)-3-ethylidenehepta-4,6-dien-2-ol (PubChem CID 89240652) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is (3E,4Z)-1-(tert-butylamino)-3-ethylidenehepta-4,6-dien-2-ol.
| Compound Name | (3E,4Z)-1-(tert-butylamino)-3-ethylidenehepta-4,6-dien-2-ol |
|---|---|
| PubChem CID | 89240652 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | (3E,4Z)-1-(tert-butylamino)-3-ethylidenehepta-4,6-dien-2-ol |
| SMILES | C=C/C=C\C(=C/C)C(O)CNC(C)(C)C |
| InChI | InChI=1S/C13H23NO/c1-6-8-9-11(7-2)12(15)10-14-13(3,4)5/h6-9,12,14-15H,1,10H2,2-5H3/b9-8-,11-7+ |
| InChIKey | CCULLINQCANQNV-NVKZJLNYSA-N |
| XLogP | 2.42 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|