About potassium;(2-cyclohexa-1,5-dien-1-yl-2-hydroxyethyl)-methylazanide;ethane
potassium;(2-cyclohexa-1,5-dien-1-yl-2-hydroxyethyl)-methylazanide;ethane (PubChem CID 143522607) has the molecular formula C13H26KNO
and a molecular weight of 251.45 g/mol. Its IUPAC name is potassium;(2-cyclohexa-1,5-dien-1-yl-2-hydroxyethyl)-methylazanide;ethane.
Molecular Properties
| Compound Name | potassium;(2-cyclohexa-1,5-dien-1-yl-2-hydroxyethyl)-methylazanide;ethane |
| PubChem CID | 143522607 |
| Molecular Formula | C13H26KNO |
| Molecular Weight | 251.45 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | potassium;(2-cyclohexa-1,5-dien-1-yl-2-hydroxyethyl)-methylazanide;ethane |
| SMILES | CC.CC.C[N-]CC(O)C1=CCCC=C1.[K+] |
| InChI | InChI=1S/C9H14NO.2C2H6.K/c1-10-7-9(11)8-5-3-2-4-6-8;2*1-2;/h3,5-6,9,11H,2,4,7H2,1H3;2*1-2H3;/q-1;;;+1 |
| InChIKey | NMVDLNZYNIFTMX-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 34.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.45 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze potassium;(2-cyclohexa-1,5-dien-1-yl-2-hydroxyethyl)-methylazanide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;(2-cyclohexa-1,5-dien-1-yl-2-hydroxyethyl)-methylazanide;ethane?
The IUPAC name of potassium;(2-cyclohexa-1,5-dien-1-yl-2-hydroxyethyl)-methylazanide;ethane (CID 143522607) is potassium;(2-cyclohexa-1,5-dien-1-yl-2-hydroxyethyl)-methylazanide;ethane.
What is the SMILES notation for potassium;(2-cyclohexa-1,5-dien-1-yl-2-hydroxyethyl)-methylazanide;ethane?
The canonical SMILES for potassium;(2-cyclohexa-1,5-dien-1-yl-2-hydroxyethyl)-methylazanide;ethane is CC.CC.C[N-]CC(O)C1=CCCC=C1.[K+].
What is the InChIKey of potassium;(2-cyclohexa-1,5-dien-1-yl-2-hydroxyethyl)-methylazanide;ethane?
The InChIKey is NMVDLNZYNIFTMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14NO.2C2H6.K/c1-10-7-9(11)8-5-3-2-4-6-8;2*1-2;/h3,5-6,9,11H,2,4,7H2,1H3;2*1-2H3;/q-1;;;+1.
What are the key properties of potassium;(2-cyclohexa-1,5-dien-1-yl-2-hydroxyethyl)-methylazanide;ethane?
potassium;(2-cyclohexa-1,5-dien-1-yl-2-hydroxyethyl)-methylazanide;ethane has a molecular weight of 251.45 g/mol, XLogP of 0.68, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;(2-cyclohexa-1,5-dien-1-yl-2-hydroxyethyl)-methylazanide;ethane is sourced from PubChem (CID 143522607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).