C14H17BrClN3O2 — CID 70585435
4-bromo-4-(4-chlorophenoxy)-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-ol (PubChem CID 70585435) has the molecular formula C14H17BrClN3O2 and a molecular weight of 374.67 g/mol. Its IUPAC name is 4-bromo-4-(4-chlorophenoxy)-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-ol.
| Compound Name | 4-bromo-4-(4-chlorophenoxy)-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 70585435 |
| Molecular Formula | C14H17BrClN3O2 |
| Molecular Weight | 374.67 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | 4-bromo-4-(4-chlorophenoxy)-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-ol |
| SMILES | CC(C)(C(O)Cn1cncn1)C(Br)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H17BrClN3O2/c1-14(2,12(20)7-19-9-17-8-18-19)13(15)21-11-5-3-10(16)4-6-11/h3-6,8-9,12-13,20H,7H2,1-2H3 |
| InChIKey | TVHWIBSCVSRRDI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.67 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|