C33H52O5 — CID 70585670
12-[(8S,9S,10R,13S,14S,17S)-1-ethyl-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-11-hydroxy-12-oxododecanoic acid (PubChem CID 70585670) has the molecular formula C33H52O5 and a molecular weight of 528.77 g/mol. Its IUPAC name is 12-[(8S,9S,10R,13S,14S,17S)-1-ethyl-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-11-hydroxy-12-oxododecanoic acid.
| Compound Name | 12-[(8S,9S,10R,13S,14S,17S)-1-ethyl-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-11-hydroxy-12-oxododecanoic acid |
|---|---|
| PubChem CID | 70585670 |
| Molecular Formula | C33H52O5 |
| Molecular Weight | 528.77 g/mol |
| Exact Mass | 528.38 |
| IUPAC Name | 12-[(8S,9S,10R,13S,14S,17S)-1-ethyl-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-11-hydroxy-12-oxododecanoic acid |
| SMILES | CCC1CC(=O)C=C2CC[C@H]3[C@@H]4CC[C@H](C(=O)C(O)CCCCCCCCCC(=O)O)[C@@]4(C)CC[C@@H]3[C@]21C |
| InChI | InChI=1S/C33H52O5/c1-4-22-20-24(34)21-23-14-15-25-26-16-17-28(32(26,2)19-18-27(25)33(22,23)3)31(38)29(35)12-10-8-6-5-7-9-11-13-30(36)37/h21-22,25-29,35H,4-20H2,1-3H3,(H,36,37)/t22?,25-,26-,27-,28+,29?,32-,33-/m0/s1 |
| InChIKey | BYGWZLVPSAVTJE-OEMLGABFSA-N |
| XLogP | 7.30 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.77 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|