C16H25FO3 — CID 70586483
(3aS,4R,5R,6aR)-4-[(3S,4R)-4-fluoro-3-hydroxyoct-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one (PubChem CID 70586483) has the molecular formula C16H25FO3 and a molecular weight of 284.37 g/mol. Its IUPAC name is (3aS,4R,5R,6aR)-4-[(3S,4R)-4-fluoro-3-hydroxyoct-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one.
| Compound Name | (3aS,4R,5R,6aR)-4-[(3S,4R)-4-fluoro-3-hydroxyoct-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 70586483 |
| Molecular Formula | C16H25FO3 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | (3aS,4R,5R,6aR)-4-[(3S,4R)-4-fluoro-3-hydroxyoct-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
| SMILES | CCCC[C@@H](F)[C@@H](O)C=C[C@@H]1[C@H]2CC(=O)C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C16H25FO3/c1-2-3-4-14(17)15(19)6-5-12-13-9-11(18)7-10(13)8-16(12)20/h5-6,10,12-16,19-20H,2-4,7-9H2,1H3/t10-,12+,13-,14+,15-,16+/m0/s1 |
| InChIKey | VRDYWSRNTVTJIZ-JIVNZTTRSA-N |
| XLogP | 2.41 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|