C17H26O3 — CID 57114894
5-hydroxy-4-(3-hydroxy-4-methylocta-1,7-dienyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one (PubChem CID 57114894) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is 5-hydroxy-4-(3-hydroxy-4-methylocta-1,7-dienyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one.
| Compound Name | 5-hydroxy-4-(3-hydroxy-4-methylocta-1,7-dienyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 57114894 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 5-hydroxy-4-(3-hydroxy-4-methylocta-1,7-dienyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
| SMILES | C=CCCC(C)C(O)C=CC1C(O)CC2CC(=O)CC21 |
| InChI | InChI=1S/C17H26O3/c1-3-4-5-11(2)16(19)7-6-14-15-10-13(18)8-12(15)9-17(14)20/h3,6-7,11-12,14-17,19-20H,1,4-5,8-10H2,2H3 |
| InChIKey | AUZPALLCCAZPKV-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|