C17H28O2 — CID 67684153
(1R,2R,3aS,6aR)-1-(4-hydroxyoct-1-enyl)-5-methylidene-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-ol (PubChem CID 67684153) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is (1R,2R,3aS,6aR)-1-(4-hydroxyoct-1-enyl)-5-methylidene-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-ol.
| Compound Name | (1R,2R,3aS,6aR)-1-(4-hydroxyoct-1-enyl)-5-methylidene-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-ol |
|---|---|
| PubChem CID | 67684153 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | (1R,2R,3aS,6aR)-1-(4-hydroxyoct-1-enyl)-5-methylidene-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-ol |
| SMILES | C=C1C[C@H]2C[C@@H](O)[C@H](C=CCC(O)CCCC)[C@@H]2C1 |
| InChI | InChI=1S/C17H28O2/c1-3-4-6-14(18)7-5-8-15-16-10-12(2)9-13(16)11-17(15)19/h5,8,13-19H,2-4,6-7,9-11H2,1H3/t13-,14?,15+,16+,17+/m0/s1 |
| InChIKey | CBNHQNFORWJZKS-KHGQFXJMSA-N |
| XLogP | 3.45 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|