C19H30O2 — CID 57089369
(1R,2R,3aS,6aR)-1-[(3S)-3-ethenyl-3-hydroxyoct-1-enyl]-5-methylidene-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-ol (PubChem CID 57089369) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is (1R,2R,3aS,6aR)-1-[(3S)-3-ethenyl-3-hydroxyoct-1-enyl]-5-methylidene-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-ol.
| Compound Name | (1R,2R,3aS,6aR)-1-[(3S)-3-ethenyl-3-hydroxyoct-1-enyl]-5-methylidene-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-ol |
|---|---|
| PubChem CID | 57089369 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | (1R,2R,3aS,6aR)-1-[(3S)-3-ethenyl-3-hydroxyoct-1-enyl]-5-methylidene-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-ol |
| SMILES | C=C[C@](O)(C=C[C@@H]1[C@@H]2CC(=C)C[C@H]2C[C@H]1O)CCCCC |
| InChI | InChI=1S/C19H30O2/c1-4-6-7-9-19(21,5-2)10-8-16-17-12-14(3)11-15(17)13-18(16)20/h5,8,10,15-18,20-21H,2-4,6-7,9,11-13H2,1H3/t15-,16+,17+,18+,19+/m0/s1 |
| InChIKey | BEFWULSINHIMIT-UURKPOQGSA-N |
| XLogP | 4.00 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|