C16H21N3O5S — CID 70586938
2-[3-(carbamimidoylsulfanylmethyl)-4-hydroxyphenyl]-2-[[(Z)-4-ethoxy-4-oxobut-2-en-2-yl]amino]acetic acid (PubChem CID 70586938) has the molecular formula C16H21N3O5S and a molecular weight of 367.43 g/mol. Its IUPAC name is 2-[3-(carbamimidoylsulfanylmethyl)-4-hydroxyphenyl]-2-[[(Z)-4-ethoxy-4-oxobut-2-en-2-yl]amino]acetic acid.
| Compound Name | 2-[3-(carbamimidoylsulfanylmethyl)-4-hydroxyphenyl]-2-[[(Z)-4-ethoxy-4-oxobut-2-en-2-yl]amino]acetic acid |
|---|---|
| PubChem CID | 70586938 |
| Molecular Formula | C16H21N3O5S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 2-[3-(carbamimidoylsulfanylmethyl)-4-hydroxyphenyl]-2-[[(Z)-4-ethoxy-4-oxobut-2-en-2-yl]amino]acetic acid |
| SMILES | [H]/N=C(\N)SCc1cc(C(N/C(C)=C\C(=O)OCC)C(=O)O)ccc1O |
| InChI | InChI=1S/C16H21N3O5S/c1-3-24-13(21)6-9(2)19-14(15(22)23)10-4-5-12(20)11(7-10)8-25-16(17)18/h4-7,14,19-20H,3,8H2,1-2H3,(H3,17,18)(H,22,23)/b9-6- |
| InChIKey | NUHFHQJMAACUFX-TWGQIWQCSA-N |
| XLogP | 1.70 |
| TPSA | 145.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|