C24H23N3O3 — CID 70590647
[cyano-(6-phenoxy-2-pyridinyl)methyl] 2-anilino-3-methylbutanoate (PubChem CID 70590647) has the molecular formula C24H23N3O3 and a molecular weight of 401.47 g/mol. Its IUPAC name is [cyano-(6-phenoxy-2-pyridinyl)methyl] 2-anilino-3-methylbutanoate.
| Compound Name | [cyano-(6-phenoxy-2-pyridinyl)methyl] 2-anilino-3-methylbutanoate |
|---|---|
| PubChem CID | 70590647 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | [cyano-(6-phenoxy-2-pyridinyl)methyl] 2-anilino-3-methylbutanoate |
| SMILES | CC(C)C(Nc1ccccc1)C(=O)OC(C#N)c1cccc(Oc2ccccc2)n1 |
| InChI | InChI=1S/C24H23N3O3/c1-17(2)23(26-18-10-5-3-6-11-18)24(28)30-21(16-25)20-14-9-15-22(27-20)29-19-12-7-4-8-13-19/h3-15,17,21,23,26H,1-2H3 |
| InChIKey | UDFBOOARMJPADW-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |