C22H27ClN2O3 — CID 88718056
1-(6-phenoxy-2-pyridinyl)ethyl 2-[[(Z)-3-chlorobut-2-enyl]amino]-3-methylbutanoate (PubChem CID 88718056) has the molecular formula C22H27ClN2O3 and a molecular weight of 402.92 g/mol. Its IUPAC name is 1-(6-phenoxy-2-pyridinyl)ethyl 2-[[(Z)-3-chlorobut-2-enyl]amino]-3-methylbutanoate.
| Compound Name | 1-(6-phenoxy-2-pyridinyl)ethyl 2-[[(Z)-3-chlorobut-2-enyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 88718056 |
| Molecular Formula | C22H27ClN2O3 |
| Molecular Weight | 402.92 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 1-(6-phenoxy-2-pyridinyl)ethyl 2-[[(Z)-3-chlorobut-2-enyl]amino]-3-methylbutanoate |
| SMILES | C/C(Cl)=C/CNC(C(=O)OC(C)c1cccc(Oc2ccccc2)n1)C(C)C |
| InChI | InChI=1S/C22H27ClN2O3/c1-15(2)21(24-14-13-16(3)23)22(26)27-17(4)19-11-8-12-20(25-19)28-18-9-6-5-7-10-18/h5-13,15,17,21,24H,14H2,1-4H3/b16-13- |
| InChIKey | YCPFTBASDQBMGZ-SSZFMOIBSA-N |
| XLogP | 5.23 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.92 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |