C26H25F2NO3 — CID 54316819
1-[6-(4-fluorophenoxy)-2-pyridinyl]ethyl 4-(4-fluorophenyl)-2-propan-2-ylbut-3-enoate (PubChem CID 54316819) has the molecular formula C26H25F2NO3 and a molecular weight of 437.49 g/mol. Its IUPAC name is 1-[6-(4-fluorophenoxy)-2-pyridinyl]ethyl 4-(4-fluorophenyl)-2-propan-2-ylbut-3-enoate.
| Compound Name | 1-[6-(4-fluorophenoxy)-2-pyridinyl]ethyl 4-(4-fluorophenyl)-2-propan-2-ylbut-3-enoate |
|---|---|
| PubChem CID | 54316819 |
| Molecular Formula | C26H25F2NO3 |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 1-[6-(4-fluorophenoxy)-2-pyridinyl]ethyl 4-(4-fluorophenyl)-2-propan-2-ylbut-3-enoate |
| SMILES | CC(OC(=O)C(C=Cc1ccc(F)cc1)C(C)C)c1cccc(Oc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C26H25F2NO3/c1-17(2)23(16-9-19-7-10-20(27)11-8-19)26(30)31-18(3)24-5-4-6-25(29-24)32-22-14-12-21(28)13-15-22/h4-18,23H,1-3H3 |
| InChIKey | SOUNEVCPDJZASF-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |