C28H23FN2O3 — CID 54418341
[cyano-[6-(2-fluorophenoxy)-2-pyridinyl]methyl] 3-methyl-2-naphthalen-2-ylbutanoate (PubChem CID 54418341) has the molecular formula C28H23FN2O3 and a molecular weight of 454.50 g/mol. Its IUPAC name is [cyano-[6-(2-fluorophenoxy)-2-pyridinyl]methyl] 3-methyl-2-naphthalen-2-ylbutanoate.
| Compound Name | [cyano-[6-(2-fluorophenoxy)-2-pyridinyl]methyl] 3-methyl-2-naphthalen-2-ylbutanoate |
|---|---|
| PubChem CID | 54418341 |
| Molecular Formula | C28H23FN2O3 |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | [cyano-[6-(2-fluorophenoxy)-2-pyridinyl]methyl] 3-methyl-2-naphthalen-2-ylbutanoate |
| SMILES | CC(C)C(C(=O)OC(C#N)c1cccc(Oc2ccccc2F)n1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C28H23FN2O3/c1-18(2)27(21-15-14-19-8-3-4-9-20(19)16-21)28(32)34-25(17-30)23-11-7-13-26(31-23)33-24-12-6-5-10-22(24)29/h3-16,18,25,27H,1-2H3 |
| InChIKey | VZAPNQSRVPGYDA-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 72.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |