C15H20N2O2 — CID 7059363
ethyl 4-(3,4,5,6-tetrahydro-2H-azepin-7-ylamino)benzoate (PubChem CID 7059363) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is ethyl 4-(3,4,5,6-tetrahydro-2H-azepin-7-ylamino)benzoate.
| Compound Name | ethyl 4-(3,4,5,6-tetrahydro-2H-azepin-7-ylamino)benzoate |
|---|---|
| PubChem CID | 7059363 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | ethyl 4-(3,4,5,6-tetrahydro-2H-azepin-7-ylamino)benzoate |
| SMILES | CCOC(=O)c1ccc(NC2=NCCCCC2)cc1 |
| InChI | InChI=1S/C15H20N2O2/c1-2-19-15(18)12-7-9-13(10-8-12)17-14-6-4-3-5-11-16-14/h7-10H,2-6,11H2,1H3,(H,16,17) |
| InChIKey | UUOYOXGDEUKLFD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |