C18H12Br2O3P+ — CID 70593965
[2,3-bis(4-bromophenyl)phenoxy]-hydroxy-oxophosphanium (PubChem CID 70593965) has the molecular formula C18H12Br2O3P+ and a molecular weight of 467.07 g/mol. Its IUPAC name is [2,3-bis(4-bromophenyl)phenoxy]-hydroxy-oxophosphanium.
| Compound Name | [2,3-bis(4-bromophenyl)phenoxy]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 70593965 |
| Molecular Formula | C18H12Br2O3P+ |
| Molecular Weight | 467.07 g/mol |
| Exact Mass | 464.89 |
| IUPAC Name | [2,3-bis(4-bromophenyl)phenoxy]-hydroxy-oxophosphanium |
| SMILES | O=[P+](O)Oc1cccc(-c2ccc(Br)cc2)c1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H11Br2O3P/c19-14-8-4-12(5-9-14)16-2-1-3-17(23-24(21)22)18(16)13-6-10-15(20)11-7-13/h1-11H/p+1 |
| InChIKey | RACXPDRVQAZUEL-UHFFFAOYSA-O |
| XLogP | 6.57 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.07 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|