C15H17ClO2 — CID 70596045
(1R,4R,6S)-6-chloro-4-(phenylmethoxymethyl)bicyclo[2.2.1]heptan-2-one (PubChem CID 70596045) has the molecular formula C15H17ClO2 and a molecular weight of 264.75 g/mol. Its IUPAC name is (1R,4R,6S)-6-chloro-4-(phenylmethoxymethyl)bicyclo[2.2.1]heptan-2-one.
| Compound Name | (1R,4R,6S)-6-chloro-4-(phenylmethoxymethyl)bicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 70596045 |
| Molecular Formula | C15H17ClO2 |
| Molecular Weight | 264.75 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | (1R,4R,6S)-6-chloro-4-(phenylmethoxymethyl)bicyclo[2.2.1]heptan-2-one |
| SMILES | O=C1C[C@]2(COCc3ccccc3)C[C@H]1[C@@H](Cl)C2 |
| InChI | InChI=1S/C15H17ClO2/c16-13-7-15(6-12(13)14(17)8-15)10-18-9-11-4-2-1-3-5-11/h1-5,12-13H,6-10H2/t12-,13-,15-/m0/s1 |
| InChIKey | HSMTWSULFUXCHB-YDHLFZDLSA-N |
| XLogP | 3.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.75 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|