C22H33NO4 — CID 70596380
(Z)-2-butoxycarbonyl-3-[4-(dibutylamino)phenyl]prop-2-enoic acid (PubChem CID 70596380) has the molecular formula C22H33NO4 and a molecular weight of 375.51 g/mol. Its IUPAC name is (Z)-2-butoxycarbonyl-3-[4-(dibutylamino)phenyl]prop-2-enoic acid.
| Compound Name | (Z)-2-butoxycarbonyl-3-[4-(dibutylamino)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 70596380 |
| Molecular Formula | C22H33NO4 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | (Z)-2-butoxycarbonyl-3-[4-(dibutylamino)phenyl]prop-2-enoic acid |
| SMILES | CCCCOC(=O)/C(=C\c1ccc(N(CCCC)CCCC)cc1)C(=O)O |
| InChI | InChI=1S/C22H33NO4/c1-4-7-14-23(15-8-5-2)19-12-10-18(11-13-19)17-20(21(24)25)22(26)27-16-9-6-3/h10-13,17H,4-9,14-16H2,1-3H3,(H,24,25)/b20-17- |
| InChIKey | RVZIOINTONGRAE-JZJYNLBNSA-N |
| XLogP | 4.90 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|